C14H11Cl2NO5S — CID 51127324
3-[(2,4-dichlorophenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid (PubChem CID 51127324) has the molecular formula C14H11Cl2NO5S and a molecular weight of 376.22 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid.
| Compound Name | 3-[(2,4-dichlorophenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid |
|---|---|
| PubChem CID | 51127324 |
| Molecular Formula | C14H11Cl2NO5S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)c(O)c(S(=O)(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO5S/c1-7-4-9(14(19)20)13(18)12(5-7)23(21,22)17-11-3-2-8(15)6-10(11)16/h2-6,17-18H,1H3,(H,19,20) |
| InChIKey | WZUYKQIXBLZCPU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |