C21H16ClF2NO5S — CID 146545997
ethyl 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxybenzoate (PubChem CID 146545997) has the molecular formula C21H16ClF2NO5S and a molecular weight of 467.88 g/mol. Its IUPAC name is ethyl 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxybenzoate.
| Compound Name | ethyl 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 146545997 |
| Molecular Formula | C21H16ClF2NO5S |
| Molecular Weight | 467.88 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | ethyl 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(O)c(S(=O)(=O)Nc2cc(-c3ccccc3)c(F)cc2F)c1 |
| InChI | InChI=1S/C21H16ClF2NO5S/c1-2-30-21(27)13-8-15(22)20(26)19(9-13)31(28,29)25-18-10-14(16(23)11-17(18)24)12-6-4-3-5-7-12/h3-11,25-26H,2H2,1H3 |
| InChIKey | LPAHJFJIVMFBNP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |