C23H19BrClF2NO6S — CID 170315165
methyl 3-[[5-[2-(2-bromoethoxy)phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-methoxybenzoate (PubChem CID 170315165) has the molecular formula C23H19BrClF2NO6S and a molecular weight of 590.83 g/mol. Its IUPAC name is methyl 3-[[5-[2-(2-bromoethoxy)phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-methoxybenzoate.
| Compound Name | methyl 3-[[5-[2-(2-bromoethoxy)phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-methoxybenzoate |
|---|---|
| PubChem CID | 170315165 |
| Molecular Formula | C23H19BrClF2NO6S |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 588.98 |
| IUPAC Name | methyl 3-[[5-[2-(2-bromoethoxy)phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(Cl)c(OC)c(S(=O)(=O)Nc2cc(-c3ccccc3OCCBr)c(F)cc2F)c1 |
| InChI | InChI=1S/C23H19BrClF2NO6S/c1-32-22-16(25)9-13(23(29)33-2)10-21(22)35(30,31)28-19-11-15(17(26)12-18(19)27)14-5-3-4-6-20(14)34-8-7-24/h3-6,9-12,28H,7-8H2,1-2H3 |
| InChIKey | LWANQUMDWVEZOC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|