C20H16ClFO5S2 — CID 159281009
methyl 3-chloro-5-[(2-fluoro-5-thiophen-2-ylphenyl)methylsulfonyl]-4-methoxybenzoate (PubChem CID 159281009) has the molecular formula C20H16ClFO5S2 and a molecular weight of 454.93 g/mol. Its IUPAC name is methyl 3-chloro-5-[(2-fluoro-5-thiophen-2-ylphenyl)methylsulfonyl]-4-methoxybenzoate.
| Compound Name | methyl 3-chloro-5-[(2-fluoro-5-thiophen-2-ylphenyl)methylsulfonyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 159281009 |
| Molecular Formula | C20H16ClFO5S2 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | methyl 3-chloro-5-[(2-fluoro-5-thiophen-2-ylphenyl)methylsulfonyl]-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(Cl)c(OC)c(S(=O)(=O)Cc2cc(-c3cccs3)ccc2F)c1 |
| InChI | InChI=1S/C20H16ClFO5S2/c1-26-19-15(21)9-13(20(23)27-2)10-18(19)29(24,25)11-14-8-12(5-6-16(14)22)17-4-3-7-28-17/h3-10H,11H2,1-2H3 |
| InChIKey | KYXMKXHQLZWIGH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |