C29H32ClF4NO6SSi — CID 170568475
methyl 3-[[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-(difluoromethyl)benzoate (PubChem CID 170568475) has the molecular formula C29H32ClF4NO6SSi and a molecular weight of 662.17 g/mol. Its IUPAC name is methyl 3-[[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-(difluoromethyl)benzoate.
| Compound Name | methyl 3-[[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-(difluoromethyl)benzoate |
|---|---|
| PubChem CID | 170568475 |
| Molecular Formula | C29H32ClF4NO6SSi |
| Molecular Weight | 662.17 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | methyl 3-[[5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-2,4-difluorophenyl]sulfamoyl]-5-chloro-4-(difluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(Cl)c(C(F)F)c(S(=O)(=O)Nc2cc(-c3ccccc3OCCO[Si](C)(C)C(C)(C)C)c(F)cc2F)c1 |
| InChI | InChI=1S/C29H32ClF4NO6SSi/c1-29(2,3)43(5,6)41-12-11-40-24-10-8-7-9-18(24)19-15-23(22(32)16-21(19)31)35-42(37,38)25-14-17(28(36)39-4)13-20(30)26(25)27(33)34/h7-10,13-16,27,35H,11-12H2,1-6H3 |
| InChIKey | ZAPXLAUFCBTEFZ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.17 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|