C30H34ClF2N5O7S — CID 174144158
tert-butyl N-[2-[2-[5-[[3-chloro-5-[(dimethylaminomethylideneamino)carbamoyl]-2-methoxyphenyl]sulfonylamino]-2,4-difluorophenyl]phenoxy]ethyl]carbamate (PubChem CID 174144158) has the molecular formula C30H34ClF2N5O7S and a molecular weight of 682.15 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[5-[[3-chloro-5-[(dimethylaminomethylideneamino)carbamoyl]-2-methoxyphenyl]sulfonylamino]-2,4-difluorophenyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[5-[[3-chloro-5-[(dimethylaminomethylideneamino)carbamoyl]-2-methoxyphenyl]sulfonylamino]-2,4-difluorophenyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 174144158 |
| Molecular Formula | C30H34ClF2N5O7S |
| Molecular Weight | 682.15 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | tert-butyl N-[2-[2-[5-[[3-chloro-5-[(dimethylaminomethylideneamino)carbamoyl]-2-methoxyphenyl]sulfonylamino]-2,4-difluorophenyl]phenoxy]ethyl]carbamate |
| SMILES | COc1c(Cl)cc(C(=O)NN=CN(C)C)cc1S(=O)(=O)Nc1cc(-c2ccccc2OCCNC(=O)OC(C)(C)C)c(F)cc1F |
| InChI | InChI=1S/C30H34ClF2N5O7S/c1-30(2,3)45-29(40)34-11-12-44-25-10-8-7-9-19(25)20-15-24(23(33)16-22(20)32)37-46(41,42)26-14-18(13-21(31)27(26)43-6)28(39)36-35-17-38(4)5/h7-10,13-17,37H,11-12H2,1-6H3,(H,34,40)(H,36,39) |
| InChIKey | AJGSFUMWBHFMQF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.15 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|