C29H37ClFNO5SSi — CID 170568499
N-[5-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2-fluorophenyl]-3-chloro-5-(hydroxymethyl)-2-methoxybenzenesulfonamide (PubChem CID 170568499) has the molecular formula C29H37ClFNO5SSi and a molecular weight of 594.22 g/mol. Its IUPAC name is N-[5-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2-fluorophenyl]-3-chloro-5-(hydroxymethyl)-2-methoxybenzenesulfonamide.
| Compound Name | N-[5-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2-fluorophenyl]-3-chloro-5-(hydroxymethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 170568499 |
| Molecular Formula | C29H37ClFNO5SSi |
| Molecular Weight | 594.22 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | N-[5-[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2-fluorophenyl]-3-chloro-5-(hydroxymethyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1c(Cl)cc(CO)cc1S(=O)(=O)Nc1cc(-c2ccccc2CCCO[Si](C)(C)C(C)(C)C)ccc1F |
| InChI | InChI=1S/C29H37ClFNO5SSi/c1-29(2,3)39(5,6)37-15-9-11-21-10-7-8-12-23(21)22-13-14-25(31)26(18-22)32-38(34,35)27-17-20(19-33)16-24(30)28(27)36-4/h7-8,10,12-14,16-18,32-33H,9,11,15,19H2,1-6H3 |
| InChIKey | GAJFCOLPHYTIOQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.22 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|