About [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate
[2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate (PubChem CID 146545966) has the molecular formula C21H16Cl2FNO4S
and a molecular weight of 468.33 g/mol. Its IUPAC name is [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate.
Molecular Properties
| Compound Name | [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate |
| PubChem CID | 146545966 |
| Molecular Formula | C21H16Cl2FNO4S |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Cl)cc(Cl)cc1S(=O)(=O)Nc1cc(-c2ccccc2)ccc1F |
| InChI | InChI=1S/C21H16Cl2FNO4S/c1-2-20(26)29-21-16(23)11-15(22)12-19(21)30(27,28)25-18-10-14(8-9-17(18)24)13-6-4-3-5-7-13/h3-12,25H,2H2,1H3 |
| InChIKey | LHOYDTGGPOTOML-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate?
The IUPAC name of [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate (CID 146545966) is [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate.
What is the SMILES notation for [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate?
The canonical SMILES for [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate is CCC(=O)Oc1c(Cl)cc(Cl)cc1S(=O)(=O)Nc1cc(-c2ccccc2)ccc1F.
What is the InChIKey of [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate?
The InChIKey is LHOYDTGGPOTOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Cl2FNO4S/c1-2-20(26)29-21-16(23)11-15(22)12-19(21)30(27,28)25-18-10-14(8-9-17(18)24)13-6-4-3-5-7-13/h3-12,25H,2H2,1H3.
What are the key properties of [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate?
[2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate has a molecular weight of 468.33 g/mol, XLogP of 5.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dichloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]phenyl] propanoate is sourced from PubChem (CID 146545966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).