C23H21ClFNO6S — CID 146601077
[2-chloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]-4-[hydroxy(methoxy)methyl]phenyl] propanoate (PubChem CID 146601077) has the molecular formula C23H21ClFNO6S and a molecular weight of 493.94 g/mol. Its IUPAC name is [2-chloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]-4-[hydroxy(methoxy)methyl]phenyl] propanoate.
| Compound Name | [2-chloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]-4-[hydroxy(methoxy)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 146601077 |
| Molecular Formula | C23H21ClFNO6S |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | [2-chloro-6-[(2-fluoro-5-phenylphenyl)sulfamoyl]-4-[hydroxy(methoxy)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Cl)cc(C(O)OC)cc1S(=O)(=O)Nc1cc(-c2ccccc2)ccc1F |
| InChI | InChI=1S/C23H21ClFNO6S/c1-3-21(27)32-22-17(24)11-16(23(28)31-2)13-20(22)33(29,30)26-19-12-15(9-10-18(19)25)14-7-5-4-6-8-14/h4-13,23,26,28H,3H2,1-2H3 |
| InChIKey | OZHABADFTQIQGK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|