C15H24FNO4Si — CID 131748526
methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-fluoropyridine-2-carboxylate (PubChem CID 131748526) has the molecular formula C15H24FNO4Si and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-fluoropyridine-2-carboxylate.
| Compound Name | methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 131748526 |
| Molecular Formula | C15H24FNO4Si |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-fluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(OCCO[Si](C)(C)C(C)(C)C)cc1F |
| InChI | InChI=1S/C15H24FNO4Si/c1-15(2,3)22(5,6)21-8-7-20-11-9-12(16)13(17-10-11)14(18)19-4/h9-10H,7-8H2,1-6H3 |
| InChIKey | CXNKAMAXFCJHAL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|