C25H22ClF2NO5S — CID 158372237
3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]-4-hydroxy-N-(4-oxopentyl)benzamide (PubChem CID 158372237) has the molecular formula C25H22ClF2NO5S and a molecular weight of 521.97 g/mol. Its IUPAC name is 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]-4-hydroxy-N-(4-oxopentyl)benzamide.
| Compound Name | 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]-4-hydroxy-N-(4-oxopentyl)benzamide |
|---|---|
| PubChem CID | 158372237 |
| Molecular Formula | C25H22ClF2NO5S |
| Molecular Weight | 521.97 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]-4-hydroxy-N-(4-oxopentyl)benzamide |
| SMILES | CC(=O)CCCNC(=O)c1cc(Cl)c(O)c(S(=O)(=O)Cc2cc(-c3ccccc3)c(F)cc2F)c1 |
| InChI | InChI=1S/C25H22ClF2NO5S/c1-15(30)6-5-9-29-25(32)17-11-20(26)24(31)23(12-17)35(33,34)14-18-10-19(22(28)13-21(18)27)16-7-3-2-4-8-16/h2-4,7-8,10-13,31H,5-6,9,14H2,1H3,(H,29,32) |
| InChIKey | GUTHAEORZNRQFD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.97 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|