C12H9Cl2NO3S — CID 4993615
3,5-dichloro-N-(2-hydroxyphenyl)benzenesulfonamide (PubChem CID 4993615) has the molecular formula C12H9Cl2NO3S and a molecular weight of 318.18 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(2-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4993615 |
| Molecular Formula | C12H9Cl2NO3S |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 3,5-dichloro-N-(2-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H9Cl2NO3S/c13-8-5-9(14)7-10(6-8)19(17,18)15-11-3-1-2-4-12(11)16/h1-7,15-16H |
| InChIKey | GIBZQVREJXSNCK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|