C13H11Cl2NO3S — CID 115753806
3,5-dichloro-N-[(2-hydroxyphenyl)methyl]benzenesulfonamide (PubChem CID 115753806) has the molecular formula C13H11Cl2NO3S and a molecular weight of 332.21 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2-hydroxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[(2-hydroxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115753806 |
| Molecular Formula | C13H11Cl2NO3S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 3,5-dichloro-N-[(2-hydroxyphenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO3S/c14-10-5-11(15)7-12(6-10)20(18,19)16-8-9-3-1-2-4-13(9)17/h1-7,16-17H,8H2 |
| InChIKey | MTYBEQSGZOWWTA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|