C9H8Cl3NO2S — CID 115638542
3,5-dichloro-N-(2-chloroprop-2-enyl)benzenesulfonamide (PubChem CID 115638542) has the molecular formula C9H8Cl3NO2S and a molecular weight of 300.59 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloroprop-2-enyl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(2-chloroprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115638542 |
| Molecular Formula | C9H8Cl3NO2S |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | 3,5-dichloro-N-(2-chloroprop-2-enyl)benzenesulfonamide |
| SMILES | C=C(Cl)CNS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H8Cl3NO2S/c1-6(10)5-13-16(14,15)9-3-7(11)2-8(12)4-9/h2-4,13H,1,5H2 |
| InChIKey | WJCGXKRPIUEKBO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |