2-(benzenesulfonamido)-3,5-dichlorobenzoic acid

C13H9Cl2NO4S — CID 43235236

IUPAC2-(benzenesulfonamido)-3,5-dichlorobenzoic acid
SMILESO=C(O)c1cc(Cl)cc(Cl)c1NS(=O)(=O)c1ccccc1
InChIInChI=1S/C13H9Cl2NO4S/c14-8-6-10(13(17)18)12(11(15)7-8)16-21(19,20)9-4-2-1-3-5-9/h1-7,16H,(H,17,18)
InChIKeyBCWAARJCQZCPAY-UHFFFAOYSA-N
MW346.19 g/mol
LogP3.49
Rot. Bonds4

About 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid

2-(benzenesulfonamido)-3,5-dichlorobenzoic acid (PubChem CID 43235236) has the molecular formula C13H9Cl2NO4S and a molecular weight of 346.19 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid.

Molecular Properties

Compound Name2-(benzenesulfonamido)-3,5-dichlorobenzoic acid
PubChem CID43235236
Molecular FormulaC13H9Cl2NO4S
Molecular Weight346.19 g/mol
Exact Mass344.96
IUPAC Name2-(benzenesulfonamido)-3,5-dichlorobenzoic acid
SMILESO=C(O)c1cc(Cl)cc(Cl)c1NS(=O)(=O)c1ccccc1
InChIInChI=1S/C13H9Cl2NO4S/c14-8-6-10(13(17)18)12(11(15)7-8)16-21(19,20)9-4-2-1-3-5-9/h1-7,16H,(H,17,18)
InChIKeyBCWAARJCQZCPAY-UHFFFAOYSA-N
XLogP3.49
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.19
LogP ≤ 53.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid?
The IUPAC name of 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid (CID 43235236) is 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid.
What is the SMILES notation for 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid?
The canonical SMILES for 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid is O=C(O)c1cc(Cl)cc(Cl)c1NS(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid?
The InChIKey is BCWAARJCQZCPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2NO4S/c14-8-6-10(13(17)18)12(11(15)7-8)16-21(19,20)9-4-2-1-3-5-9/h1-7,16H,(H,17,18).
What are the key properties of 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid?
2-(benzenesulfonamido)-3,5-dichlorobenzoic acid has a molecular weight of 346.19 g/mol, XLogP of 3.49, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonamido)-3,5-dichlorobenzoic acid is sourced from PubChem (CID 43235236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).