C14H10F2O4S — CID 60972281
4-[(2,5-difluorophenyl)methylsulfonyl]benzoic acid (PubChem CID 60972281) has the molecular formula C14H10F2O4S and a molecular weight of 312.29 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methylsulfonyl]benzoic acid.
| Compound Name | 4-[(2,5-difluorophenyl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 60972281 |
| Molecular Formula | C14H10F2O4S |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Cc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C14H10F2O4S/c15-11-3-6-13(16)10(7-11)8-21(19,20)12-4-1-9(2-5-12)14(17)18/h1-7H,8H2,(H,17,18) |
| InChIKey | ASENFEAUWTWBCX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |