C13H9F3O2S — CID 64717962
2,4-difluoro-1-[(4-fluorophenyl)sulfonylmethyl]benzene (PubChem CID 64717962) has the molecular formula C13H9F3O2S and a molecular weight of 286.27 g/mol. Its IUPAC name is 2,4-difluoro-1-[(4-fluorophenyl)sulfonylmethyl]benzene.
| Compound Name | 2,4-difluoro-1-[(4-fluorophenyl)sulfonylmethyl]benzene |
|---|---|
| PubChem CID | 64717962 |
| Molecular Formula | C13H9F3O2S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2,4-difluoro-1-[(4-fluorophenyl)sulfonylmethyl]benzene |
| SMILES | O=S(=O)(Cc1ccc(F)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H9F3O2S/c14-10-3-5-12(6-4-10)19(17,18)8-9-1-2-11(15)7-13(9)16/h1-7H,8H2 |
| InChIKey | VQSPWGTWPIZMOF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |