C14H8ClF2NO2S — CID 158690266
3-chloro-5-[(2,4-difluorophenyl)methylsulfonyl]benzonitrile (PubChem CID 158690266) has the molecular formula C14H8ClF2NO2S and a molecular weight of 327.74 g/mol. Its IUPAC name is 3-chloro-5-[(2,4-difluorophenyl)methylsulfonyl]benzonitrile.
| Compound Name | 3-chloro-5-[(2,4-difluorophenyl)methylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 158690266 |
| Molecular Formula | C14H8ClF2NO2S |
| Molecular Weight | 327.74 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3-chloro-5-[(2,4-difluorophenyl)methylsulfonyl]benzonitrile |
| SMILES | N#Cc1cc(Cl)cc(S(=O)(=O)Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H8ClF2NO2S/c15-11-3-9(7-18)4-13(5-11)21(19,20)8-10-1-2-12(16)6-14(10)17/h1-6H,8H2 |
| InChIKey | IYAMSQIRSGDYSY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |