C20H12ClF2NO2S — CID 158172879
2-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzonitrile (PubChem CID 158172879) has the molecular formula C20H12ClF2NO2S and a molecular weight of 403.84 g/mol. Its IUPAC name is 2-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzonitrile.
| Compound Name | 2-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 158172879 |
| Molecular Formula | C20H12ClF2NO2S |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 2-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzonitrile |
| SMILES | N#Cc1cc(S(=O)(=O)Cc2cc(-c3ccccc3)c(F)cc2F)ccc1Cl |
| InChI | InChI=1S/C20H12ClF2NO2S/c21-18-7-6-16(8-14(18)11-24)27(25,26)12-15-9-17(20(23)10-19(15)22)13-4-2-1-3-5-13/h1-10H,12H2 |
| InChIKey | FXRAWYWZBXAJSE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |