C16H15NO2S — CID 64692198
2-[(3,4-dimethylphenyl)sulfonylmethyl]benzonitrile (PubChem CID 64692198) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)sulfonylmethyl]benzonitrile.
| Compound Name | 2-[(3,4-dimethylphenyl)sulfonylmethyl]benzonitrile |
|---|---|
| PubChem CID | 64692198 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)sulfonylmethyl]benzonitrile |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccccc2C#N)cc1C |
| InChI | InChI=1S/C16H15NO2S/c1-12-7-8-16(9-13(12)2)20(18,19)11-15-6-4-3-5-14(15)10-17/h3-9H,11H2,1-2H3 |
| InChIKey | GMPGDMUVLPVYQX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |