C17H14Cl2O2 — CID 162252914
1-(3,5-dichlorophenyl)-3-[2-(1-hydroxyethenyl)phenyl]propan-2-one (PubChem CID 162252914) has the molecular formula C17H14Cl2O2 and a molecular weight of 321.20 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[2-(1-hydroxyethenyl)phenyl]propan-2-one.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[2-(1-hydroxyethenyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 162252914 |
| Molecular Formula | C17H14Cl2O2 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[2-(1-hydroxyethenyl)phenyl]propan-2-one |
| SMILES | C=C(O)c1ccccc1CC(=O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2O2/c1-11(20)17-5-3-2-4-13(17)9-16(21)8-12-6-14(18)10-15(19)7-12/h2-7,10,20H,1,8-9H2 |
| InChIKey | GNBYTONCMQIMJH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|