C9H6Cl2O3 — CID 60790009
3-(3,5-dichlorophenyl)-2-oxopropanoic acid (PubChem CID 60790009) has the molecular formula C9H6Cl2O3 and a molecular weight of 233.05 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2-oxopropanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-2-oxopropanoic acid |
|---|---|
| PubChem CID | 60790009 |
| Molecular Formula | C9H6Cl2O3 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2O3/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4H,3H2,(H,13,14) |
| InChIKey | AIWZBFDXFOBWOM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|