C12H11ClO5 — CID 43444874
3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-oxopropanoic acid (PubChem CID 43444874) has the molecular formula C12H11ClO5 and a molecular weight of 270.67 g/mol. Its IUPAC name is 3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-oxopropanoic acid.
| Compound Name | 3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-oxopropanoic acid |
|---|---|
| PubChem CID | 43444874 |
| Molecular Formula | C12H11ClO5 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)Cc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H11ClO5/c13-8-4-7(5-9(14)12(15)16)6-10-11(8)18-3-1-2-17-10/h4,6H,1-3,5H2,(H,15,16) |
| InChIKey | UNQJCUKJULFUCZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|