C14H17ClN2O5 — CID 51111102
ethyl N-[[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]amino]carbamate (PubChem CID 51111102) has the molecular formula C14H17ClN2O5 and a molecular weight of 328.75 g/mol. Its IUPAC name is ethyl N-[[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]amino]carbamate.
| Compound Name | ethyl N-[[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 51111102 |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | ethyl N-[[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)Cc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C14H17ClN2O5/c1-2-20-14(19)17-16-12(18)8-9-6-10(15)13-11(7-9)21-4-3-5-22-13/h6-7H,2-5,8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | MBRMQWHUXRIYAN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|