C21H23ClN2O5 — CID 55445995
2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]acetohydrazide (PubChem CID 55445995) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55445995 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)Cc2cc(Cl)c3c(c2)OCCCO3)cc1C |
| InChI | InChI=1S/C21H23ClN2O5/c1-13-4-5-16(8-14(13)2)29-12-20(26)24-23-19(25)11-15-9-17(22)21-18(10-15)27-6-3-7-28-21/h4-5,8-10H,3,6-7,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | WODMVKTYHXEZEM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|