C20H22ClN3O4 — CID 18206093
2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(4-methylanilino)acetyl]acetohydrazide (PubChem CID 18206093) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(4-methylanilino)acetyl]acetohydrazide.
| Compound Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(4-methylanilino)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 18206093 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N'-[2-(4-methylanilino)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cc2cc(Cl)c3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-13-3-5-15(6-4-13)22-12-19(26)24-23-18(25)11-14-9-16(21)20-17(10-14)27-7-2-8-28-20/h3-6,9-10,22H,2,7-8,11-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | QSACYAXXDVYTED-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|