C15H12Cl2O2 — CID 62033281
1-(3,5-dichlorophenoxy)-3-phenylpropan-2-one (PubChem CID 62033281) has the molecular formula C15H12Cl2O2 and a molecular weight of 295.17 g/mol. Its IUPAC name is 1-(3,5-dichlorophenoxy)-3-phenylpropan-2-one.
| Compound Name | 1-(3,5-dichlorophenoxy)-3-phenylpropan-2-one |
|---|---|
| PubChem CID | 62033281 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 1-(3,5-dichlorophenoxy)-3-phenylpropan-2-one |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C15H12Cl2O2/c16-12-7-13(17)9-15(8-12)19-10-14(18)6-11-4-2-1-3-5-11/h1-5,7-9H,6,10H2 |
| InChIKey | VADHCMVDBNKTHS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |