C25H22BrNO4S — CID 148860398
1-[5-bromo-6-[[2-(1-hydroxyethenyl)-5-phenylphenyl]methylsulfonyl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 148860398) has the molecular formula C25H22BrNO4S and a molecular weight of 512.43 g/mol. Its IUPAC name is 1-[5-bromo-6-[[2-(1-hydroxyethenyl)-5-phenylphenyl]methylsulfonyl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-bromo-6-[[2-(1-hydroxyethenyl)-5-phenylphenyl]methylsulfonyl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 148860398 |
| Molecular Formula | C25H22BrNO4S |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 1-[5-bromo-6-[[2-(1-hydroxyethenyl)-5-phenylphenyl]methylsulfonyl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | C=C(O)c1ccc(-c2ccccc2)cc1CS(=O)(=O)c1cc2c(cc1Br)CCN2C(C)=O |
| InChI | InChI=1S/C25H22BrNO4S/c1-16(28)22-9-8-19(18-6-4-3-5-7-18)12-21(22)15-32(30,31)25-14-24-20(13-23(25)26)10-11-27(24)17(2)29/h3-9,12-14,28H,1,10-11,15H2,2H3 |
| InChIKey | OZFBDXFBOCDLTK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|