C21H15ClFNO4S — CID 158364271
6-chloro-7-[(2-fluoro-5-phenylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 158364271) has the molecular formula C21H15ClFNO4S and a molecular weight of 431.87 g/mol. Its IUPAC name is 6-chloro-7-[(2-fluoro-5-phenylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-chloro-7-[(2-fluoro-5-phenylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 158364271 |
| Molecular Formula | C21H15ClFNO4S |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 6-chloro-7-[(2-fluoro-5-phenylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(S(=O)(=O)Cc3cc(-c4ccccc4)ccc3F)c(Cl)cc2N1 |
| InChI | InChI=1S/C21H15ClFNO4S/c22-16-9-18-19(28-11-21(25)24-18)10-20(16)29(26,27)12-15-8-14(6-7-17(15)23)13-4-2-1-3-5-13/h1-10H,11-12H2,(H,24,25) |
| InChIKey | GTVJNCCBQXILEX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |