C21H17ClN2O4S — CID 52579392
N-benzhydryl-6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonamide (PubChem CID 52579392) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is N-benzhydryl-6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonamide.
| Compound Name | N-benzhydryl-6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 52579392 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-benzhydryl-6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonamide |
| SMILES | O=C1COc2cc(S(=O)(=O)NC(c3ccccc3)c3ccccc3)c(Cl)cc2N1 |
| InChI | InChI=1S/C21H17ClN2O4S/c22-16-11-17-18(28-13-20(25)23-17)12-19(16)29(26,27)24-21(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,21,24H,13H2,(H,23,25) |
| InChIKey | GMXDJHJJNVPZHJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |