C18H13FO4S2 — CID 58390703
3-[(2-fluorophenyl)sulfonylmethyl]-5-phenylthiophene-2-carboxylic acid (PubChem CID 58390703) has the molecular formula C18H13FO4S2 and a molecular weight of 376.43 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfonylmethyl]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[(2-fluorophenyl)sulfonylmethyl]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58390703 |
| Molecular Formula | C18H13FO4S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfonylmethyl]-5-phenylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccccc2)cc1CS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C18H13FO4S2/c19-14-8-4-5-9-16(14)25(22,23)11-13-10-15(24-17(13)18(20)21)12-6-2-1-3-7-12/h1-10H,11H2,(H,20,21) |
| InChIKey | KHQXCSJPFWBWFA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |