C22H17NO4S2 — CID 58390751
3-[(2-methylphenyl)sulfonylmethyl]-5-quinolin-8-ylthiophene-2-carboxylic acid (PubChem CID 58390751) has the molecular formula C22H17NO4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 3-[(2-methylphenyl)sulfonylmethyl]-5-quinolin-8-ylthiophene-2-carboxylic acid.
| Compound Name | 3-[(2-methylphenyl)sulfonylmethyl]-5-quinolin-8-ylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58390751 |
| Molecular Formula | C22H17NO4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-[(2-methylphenyl)sulfonylmethyl]-5-quinolin-8-ylthiophene-2-carboxylic acid |
| SMILES | Cc1ccccc1S(=O)(=O)Cc1cc(-c2cccc3cccnc23)sc1C(=O)O |
| InChI | InChI=1S/C22H17NO4S2/c1-14-6-2-3-10-19(14)29(26,27)13-16-12-18(28-21(16)22(24)25)17-9-4-7-15-8-5-11-23-20(15)17/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | DNUOMDCFISLUNN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |