C19H13F3O5S2 — CID 58390754
5-phenyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylmethyl]thiophene-2-carboxylic acid (PubChem CID 58390754) has the molecular formula C19H13F3O5S2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 5-phenyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylmethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-phenyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylmethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58390754 |
| Molecular Formula | C19H13F3O5S2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 5-phenyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylmethyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccccc2)cc1CS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C19H13F3O5S2/c20-19(21,22)27-14-8-4-5-9-16(14)29(25,26)11-13-10-15(28-17(13)18(23)24)12-6-2-1-3-7-12/h1-10H,11H2,(H,23,24) |
| InChIKey | YUCMLBMPQLDQGW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |