C17H12ClNO4S2 — CID 58390770
5-(4-chlorophenyl)-3-(pyridin-2-ylsulfonylmethyl)thiophene-2-carboxylic acid (PubChem CID 58390770) has the molecular formula C17H12ClNO4S2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(pyridin-2-ylsulfonylmethyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-chlorophenyl)-3-(pyridin-2-ylsulfonylmethyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58390770 |
| Molecular Formula | C17H12ClNO4S2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(pyridin-2-ylsulfonylmethyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccc(Cl)cc2)cc1CS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C17H12ClNO4S2/c18-13-6-4-11(5-7-13)14-9-12(16(24-14)17(20)21)10-25(22,23)15-3-1-2-8-19-15/h1-9H,10H2,(H,20,21) |
| InChIKey | NSHJXBGDNQULGU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |