C22H20N4O3S — CID 156759085
3-ethoxy-5-[6-(2-quinolin-8-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid (PubChem CID 156759085) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-ethoxy-5-[6-(2-quinolin-8-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid.
| Compound Name | 3-ethoxy-5-[6-(2-quinolin-8-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 156759085 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-ethoxy-5-[6-(2-quinolin-8-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid |
| SMILES | CCOc1cc(-c2cc(NCCc3cccc4cccnc34)ncn2)sc1C(=O)O |
| InChI | InChI=1S/C22H20N4O3S/c1-2-29-17-12-18(30-21(17)22(27)28)16-11-19(26-13-25-16)23-10-8-15-6-3-5-14-7-4-9-24-20(14)15/h3-7,9,11-13H,2,8,10H2,1H3,(H,27,28)(H,23,25,26) |
| InChIKey | LSMRRTBJUODOJN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |