C19H17ClN4O5S — CID 146624158
5-[6-[2-(4-chloro-2-nitrophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid (PubChem CID 146624158) has the molecular formula C19H17ClN4O5S and a molecular weight of 448.89 g/mol. Its IUPAC name is 5-[6-[2-(4-chloro-2-nitrophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid.
| Compound Name | 5-[6-[2-(4-chloro-2-nitrophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 146624158 |
| Molecular Formula | C19H17ClN4O5S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 5-[6-[2-(4-chloro-2-nitrophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid |
| SMILES | CCOc1cc(-c2cc(NCCc3ccc(Cl)cc3[N+](=O)[O-])ncn2)sc1C(=O)O |
| InChI | InChI=1S/C19H17ClN4O5S/c1-2-29-15-9-16(30-18(15)19(25)26)13-8-17(23-10-22-13)21-6-5-11-3-4-12(20)7-14(11)24(27)28/h3-4,7-10H,2,5-6H2,1H3,(H,25,26)(H,21,22,23) |
| InChIKey | XPUUZZNEHUPCFL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|