C21H20N4O3S — CID 166687855
3-ethoxy-5-[6-(2-indol-1-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid (PubChem CID 166687855) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-ethoxy-5-[6-(2-indol-1-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid.
| Compound Name | 3-ethoxy-5-[6-(2-indol-1-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 166687855 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-ethoxy-5-[6-(2-indol-1-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid |
| SMILES | CCOc1cc(-c2cc(NCCn3ccc4ccccc43)ncn2)sc1C(=O)O |
| InChI | InChI=1S/C21H20N4O3S/c1-2-28-17-12-18(29-20(17)21(26)27)15-11-19(24-13-23-15)22-8-10-25-9-7-14-5-3-4-6-16(14)25/h3-7,9,11-13H,2,8,10H2,1H3,(H,26,27)(H,22,23,24) |
| InChIKey | WHIYYDJZVHPKTC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |