C19H20BrN5O2S — CID 157437008
5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N'-hydroxythiophene-2-carboximidamide (PubChem CID 157437008) has the molecular formula C19H20BrN5O2S and a molecular weight of 462.37 g/mol. Its IUPAC name is 5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N'-hydroxythiophene-2-carboximidamide.
| Compound Name | 5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N'-hydroxythiophene-2-carboximidamide |
|---|---|
| PubChem CID | 157437008 |
| Molecular Formula | C19H20BrN5O2S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N'-hydroxythiophene-2-carboximidamide |
| SMILES | CCOc1cc(-c2cc(NCCc3ccc(Br)cc3)ncn2)sc1C(N)=NO |
| InChI | InChI=1S/C19H20BrN5O2S/c1-2-27-15-10-16(28-18(15)19(21)25-26)14-9-17(24-11-23-14)22-8-7-12-3-5-13(20)6-4-12/h3-6,9-11,26H,2,7-8H2,1H3,(H2,21,25)(H,22,23,24) |
| InChIKey | BRFNGVVXHKWDSI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|