C19H18BrN3O2S — CID 135381280
methyl 2-[5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]acetate (PubChem CID 135381280) has the molecular formula C19H18BrN3O2S and a molecular weight of 432.34 g/mol. Its IUPAC name is methyl 2-[5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 135381280 |
| Molecular Formula | C19H18BrN3O2S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | methyl 2-[5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(-c2cc(NCCc3ccc(Br)cc3)ncn2)s1 |
| InChI | InChI=1S/C19H18BrN3O2S/c1-25-19(24)10-15-6-7-17(26-15)16-11-18(23-12-22-16)21-9-8-13-2-4-14(20)5-3-13/h2-7,11-12H,8-10H2,1H3,(H,21,22,23) |
| InChIKey | XKGZWTOHXASASA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |