C19H20BrN5O2S — CID 135380225
[5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]urea (PubChem CID 135380225) has the molecular formula C19H20BrN5O2S and a molecular weight of 462.37 g/mol. Its IUPAC name is [5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]urea.
| Compound Name | [5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]urea |
|---|---|
| PubChem CID | 135380225 |
| Molecular Formula | C19H20BrN5O2S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | [5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]urea |
| SMILES | CCOc1cc(-c2cc(NCCc3ccc(Br)cc3)ncn2)sc1NC(N)=O |
| InChI | InChI=1S/C19H20BrN5O2S/c1-2-27-15-10-16(28-18(15)25-19(21)26)14-9-17(24-11-23-14)22-8-7-12-3-5-13(20)6-4-12/h3-6,9-11H,2,7-8H2,1H3,(H3,21,25,26)(H,22,23,24) |
| InChIKey | AEJSHEQIZSWUBA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |