C19H19BrN4O3S — CID 135381005
[5-[4-[2-(4-bromophenyl)ethylamino]pyrimidin-2-yl]-3-ethoxythiophen-2-yl]carbamic acid (PubChem CID 135381005) has the molecular formula C19H19BrN4O3S and a molecular weight of 463.36 g/mol. Its IUPAC name is [5-[4-[2-(4-bromophenyl)ethylamino]pyrimidin-2-yl]-3-ethoxythiophen-2-yl]carbamic acid.
| Compound Name | [5-[4-[2-(4-bromophenyl)ethylamino]pyrimidin-2-yl]-3-ethoxythiophen-2-yl]carbamic acid |
|---|---|
| PubChem CID | 135381005 |
| Molecular Formula | C19H19BrN4O3S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | [5-[4-[2-(4-bromophenyl)ethylamino]pyrimidin-2-yl]-3-ethoxythiophen-2-yl]carbamic acid |
| SMILES | CCOc1cc(-c2nccc(NCCc3ccc(Br)cc3)n2)sc1NC(=O)O |
| InChI | InChI=1S/C19H19BrN4O3S/c1-2-27-14-11-15(28-18(14)24-19(25)26)17-22-10-8-16(23-17)21-9-7-12-3-5-13(20)6-4-12/h3-6,8,10-11,24H,2,7,9H2,1H3,(H,25,26)(H,21,22,23) |
| InChIKey | QIRZGZNCMCZMCS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |