C21H23BrN4O3S — CID 174993984
5-[6-[1-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N-methoxy-N-methylthiophene-2-carboxamide (PubChem CID 174993984) has the molecular formula C21H23BrN4O3S and a molecular weight of 491.41 g/mol. Its IUPAC name is 5-[6-[1-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N-methoxy-N-methylthiophene-2-carboxamide.
| Compound Name | 5-[6-[1-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N-methoxy-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 174993984 |
| Molecular Formula | C21H23BrN4O3S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 5-[6-[1-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N-methoxy-N-methylthiophene-2-carboxamide |
| SMILES | CCOc1cc(-c2cc(NC(C)c3ccc(Br)cc3)ncn2)sc1C(=O)N(C)OC |
| InChI | InChI=1S/C21H23BrN4O3S/c1-5-29-17-11-18(30-20(17)21(27)26(3)28-4)16-10-19(24-12-23-16)25-13(2)14-6-8-15(22)9-7-14/h6-13H,5H2,1-4H3,(H,23,24,25) |
| InChIKey | PJDRTJPZLKOQEV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|