C18H11F2NO3S — CID 23602083
3-[(2,6-difluorobenzoyl)amino]-5-phenylthiophene-2-carboxylic acid (PubChem CID 23602083) has the molecular formula C18H11F2NO3S and a molecular weight of 359.35 g/mol. Its IUPAC name is 3-[(2,6-difluorobenzoyl)amino]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[(2,6-difluorobenzoyl)amino]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 23602083 |
| Molecular Formula | C18H11F2NO3S |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 3-[(2,6-difluorobenzoyl)amino]-5-phenylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccccc2)cc1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C18H11F2NO3S/c19-11-7-4-8-12(20)15(11)17(22)21-13-9-14(25-16(13)18(23)24)10-5-2-1-3-6-10/h1-9H,(H,21,22)(H,23,24) |
| InChIKey | GOMKZQISFHVMJW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |