C13H8NO5S- — CID 59871706
2-[(2-carboxy-5-phenylthiophen-3-yl)amino]-2-oxoacetate (PubChem CID 59871706) has the molecular formula C13H8NO5S- and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[(2-carboxy-5-phenylthiophen-3-yl)amino]-2-oxoacetate.
| Compound Name | 2-[(2-carboxy-5-phenylthiophen-3-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 59871706 |
| Molecular Formula | C13H8NO5S- |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-[(2-carboxy-5-phenylthiophen-3-yl)amino]-2-oxoacetate |
| SMILES | O=C([O-])C(=O)Nc1cc(-c2ccccc2)sc1C(=O)O |
| InChI | InChI=1S/C13H9NO5S/c15-11(13(18)19)14-8-6-9(20-10(8)12(16)17)7-4-2-1-3-5-7/h1-6H,(H,14,15)(H,16,17)(H,18,19)/p-1 |
| InChIKey | DUHCMTOALIAKCK-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|