C22H17NO8S — CID 59871711
5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]-3-(oxaloamino)thiophene-2-carboxylic acid (PubChem CID 59871711) has the molecular formula C22H17NO8S and a molecular weight of 455.44 g/mol. Its IUPAC name is 5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]-3-(oxaloamino)thiophene-2-carboxylic acid.
| Compound Name | 5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]-3-(oxaloamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59871711 |
| Molecular Formula | C22H17NO8S |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]-3-(oxaloamino)thiophene-2-carboxylic acid |
| SMILES | COc1ccccc1C(=O)COc1ccc(-c2cc(NC(=O)C(=O)O)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C22H17NO8S/c1-30-17-5-3-2-4-14(17)16(24)11-31-13-8-6-12(7-9-13)18-10-15(19(32-18)21(26)27)23-20(25)22(28)29/h2-10H,11H2,1H3,(H,23,25)(H,26,27)(H,28,29) |
| InChIKey | SBJBDOZUGFZZOF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|