C22H15NNa2O8S — CID 160787202
disodium;3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate (PubChem CID 160787202) has the molecular formula C22H15NNa2O8S and a molecular weight of 499.41 g/mol. Its IUPAC name is disodium;3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate.
| Compound Name | disodium;3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 160787202 |
| Molecular Formula | C22H15NNa2O8S |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | disodium;3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate |
| SMILES | COc1ccccc1C(=O)COc1ccc(-c2cc(NC(=O)C(=O)[O-])c(C(=O)[O-])s2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H17NO8S.2Na/c1-30-17-5-3-2-4-14(17)16(24)11-31-13-8-6-12(7-9-13)18-10-15(19(32-18)21(26)27)23-20(25)22(28)29;;/h2-10H,11H2,1H3,(H,23,25)(H,26,27)(H,28,29);;/q;2*+1/p-2 |
| InChIKey | LXAFNTCUJHFKHB-UHFFFAOYSA-L |
| XLogP | -5.25 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | -5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|