C23H19NO4 — CID 7627777
4-[4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]phenyl]benzonitrile (PubChem CID 7627777) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 7627777 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-[4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]phenyl]benzonitrile |
| SMILES | COc1ccc(OC)c(C(=O)COc2ccc(-c3ccc(C#N)cc3)cc2)c1 |
| InChI | InChI=1S/C23H19NO4/c1-26-20-11-12-23(27-2)21(13-20)22(25)15-28-19-9-7-18(8-10-19)17-5-3-16(14-24)4-6-17/h3-13H,15H2,1-2H3 |
| InChIKey | SGIBMXPXHVSWFE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |