C22H15NO8S-2 — CID 59871710
3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate (PubChem CID 59871710) has the molecular formula C22H15NO8S-2 and a molecular weight of 453.43 g/mol. Its IUPAC name is 3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate.
| Compound Name | 3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59871710 |
| Molecular Formula | C22H15NO8S-2 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 3-[(carboxylatoformyl)amino]-5-[4-[2-(2-methoxyphenyl)-2-oxoethoxy]phenyl]thiophene-2-carboxylate |
| SMILES | COc1ccccc1C(=O)COc1ccc(-c2cc(NC(=O)C(=O)[O-])c(C(=O)[O-])s2)cc1 |
| InChI | InChI=1S/C22H17NO8S/c1-30-17-5-3-2-4-14(17)16(24)11-31-13-8-6-12(7-9-13)18-10-15(19(32-18)21(26)27)23-20(25)22(28)29/h2-10H,11H2,1H3,(H,23,25)(H,26,27)(H,28,29)/p-2 |
| InChIKey | SBJBDOZUGFZZOF-UHFFFAOYSA-L |
| XLogP | 0.74 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|