C19H11Cl5O5S — CID 54386110
4-[bis(3,5-dichloro-2-hydroxyphenyl)methyl]-2-chlorobenzenesulfonic acid (PubChem CID 54386110) has the molecular formula C19H11Cl5O5S and a molecular weight of 528.62 g/mol. Its IUPAC name is 4-[bis(3,5-dichloro-2-hydroxyphenyl)methyl]-2-chlorobenzenesulfonic acid.
| Compound Name | 4-[bis(3,5-dichloro-2-hydroxyphenyl)methyl]-2-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 54386110 |
| Molecular Formula | C19H11Cl5O5S |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 525.88 |
| IUPAC Name | 4-[bis(3,5-dichloro-2-hydroxyphenyl)methyl]-2-chlorobenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C(c2cc(Cl)cc(Cl)c2O)c2cc(Cl)cc(Cl)c2O)cc1Cl |
| InChI | InChI=1S/C19H11Cl5O5S/c20-9-4-11(18(25)14(23)6-9)17(12-5-10(21)7-15(24)19(12)26)8-1-2-16(13(22)3-8)30(27,28)29/h1-7,17,25-26H,(H,27,28,29) |
| InChIKey | VDJDBDXBMVNOTG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|