C9H6Cl2O2 — CID 75293985
3-(3,5-dichloro-2-hydroxyphenyl)prop-2-enal (PubChem CID 75293985) has the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-hydroxyphenyl)prop-2-enal.
| Compound Name | 3-(3,5-dichloro-2-hydroxyphenyl)prop-2-enal |
|---|---|
| PubChem CID | 75293985 |
| Molecular Formula | C9H6Cl2O2 |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 3-(3,5-dichloro-2-hydroxyphenyl)prop-2-enal |
| SMILES | O=CC=Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C9H6Cl2O2/c10-7-4-6(2-1-3-12)9(13)8(11)5-7/h1-5,13H |
| InChIKey | SNOAZMIQYJHFJW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|